4-hydroxy-2-[(2-hydroxybenzoyl)amino]benzoic acid structure
|
Common Name | 4-hydroxy-2-[(2-hydroxybenzoyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 115610-40-7 | Molecular Weight | 273.24100 | |
| Density | 1.537g/cm3 | Boiling Point | 441.6ºC at 760mmHg | |
| Molecular Formula | C14H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | 4-hydroxy-2-[(2-hydroxybenzoyl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.537g/cm3 |
|---|---|
| Boiling Point | 441.6ºC at 760mmHg |
| Molecular Formula | C14H11NO5 |
| Molecular Weight | 273.24100 |
| Flash Point | 220.9ºC |
| Exact Mass | 273.06400 |
| PSA | 110.35000 |
| LogP | 2.43230 |
| Vapour Pressure | 1.41E-08mmHg at 25°C |
| Index of Refraction | 1.738 |
| InChIKey | HNFFABULNXWPDD-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cc(O)ccc1C(=O)O)c1ccccc1O |
|
~71%
4-hydroxy-2-[(2... CAS#:115610-40-7 |
| Literature: Hauteville; Ponchet; Ricci; Favre-Bonvin Journal of Heterocyclic Chemistry, 1988 , vol. 25, # 3 p. 715 - 718 |
|
~%
4-hydroxy-2-[(2... CAS#:115610-40-7 |
| Literature: Hauteville; Ponchet; Ricci; Favre-Bonvin Journal of Heterocyclic Chemistry, 1988 , vol. 25, # 3 p. 715 - 718 |
|
~%
4-hydroxy-2-[(2... CAS#:115610-40-7 |
| Literature: Hauteville; Ponchet; Ricci; Favre-Bonvin Journal of Heterocyclic Chemistry, 1988 , vol. 25, # 3 p. 715 - 718 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-salicoyl-4-hydroxyanthranilic acid |