4-[(2,2-dichloroacetyl)amino]benzoic acid structure
|
Common Name | 4-[(2,2-dichloroacetyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 7146-73-8 | Molecular Weight | 248.06300 | |
| Density | 1.568g/cm3 | Boiling Point | 464ºC at 760 mmHg | |
| Molecular Formula | C9H7Cl2NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.4ºC | |
| Name | 4-[(2,2-dichloroacetyl)amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.568g/cm3 |
|---|---|
| Boiling Point | 464ºC at 760 mmHg |
| Molecular Formula | C9H7Cl2NO3 |
| Molecular Weight | 248.06300 |
| Flash Point | 234.4ºC |
| Exact Mass | 246.98000 |
| PSA | 66.40000 |
| LogP | 2.20000 |
| Index of Refraction | 1.641 |
| InChIKey | FELCOLZFVJIGLE-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NC(=O)C(Cl)Cl)cc1 |
|
~%
4-[(2,2-dichlor... CAS#:7146-73-8 |
| Literature: Phillips Journal of the American Chemical Society, 1952 , vol. 74, p. 6125 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Dichloracetamino-benzoesaeure |
| Dichloroacetyl-p-aminobenzoic acid |
| p-Dichloracetyl-amino-benzoesaeure |