ethyl 2-bromo-2-fluoro-2-phenoxyacetate structure
|
Common Name | ethyl 2-bromo-2-fluoro-2-phenoxyacetate | ||
|---|---|---|---|---|
| CAS Number | 115821-21-1 | Molecular Weight | 277.08700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10BrFO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-bromo-2-fluoro-2-phenoxyacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10BrFO3 |
|---|---|
| Molecular Weight | 277.08700 |
| Exact Mass | 275.98000 |
| PSA | 35.53000 |
| LogP | 2.64670 |
| InChIKey | UNYUSJHWKHNNPQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(F)(Br)Oc1ccccc1 |
|
~46%
ethyl 2-bromo-2... CAS#:115821-21-1 |
| Literature: Takeuchi, Yoshio; Asahina, Masahiro; Hori, Kozo; Koizumi, Toru Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 1149 - 1154 |
|
~%
ethyl 2-bromo-2... CAS#:115821-21-1 |
| Literature: Takeuchi, Yoshio; Asahina, Masahiro; Hori, Kozo; Koizumi, Toru Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 1149 - 1154 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Acetic acid,bromofluorophenoxy-,ethyl ester |