2,5-Diaminobenzoic acid dihydrochloride structure
|
Common Name | 2,5-Diaminobenzoic acid dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1158259-09-6 | Molecular Weight | 225.07200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H10Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-Diamino-benzoic acid dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H10Cl2N2O2 |
|---|---|
| Molecular Weight | 225.07200 |
| Exact Mass | 224.01200 |
| PSA | 89.34000 |
| LogP | 3.31560 |
| InChIKey | DYYLTSSEVZXCSY-UHFFFAOYSA-N |
| SMILES | Cl.Cl.Nc1ccc(N)c(C(=O)O)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922499990 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| MFCD01596222 |