oxetan-2-ylmethyl 4-methylbenzene-1-sulfonate structure
|
Common Name | oxetan-2-ylmethyl 4-methylbenzene-1-sulfonate | ||
|---|---|---|---|---|
| CAS Number | 115845-51-7 | Molecular Weight | 242.29100 | |
| Density | 1.263g/cm3 | Boiling Point | 383.817ºC at 760 mmHg | |
| Molecular Formula | C11H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.926ºC | |
| Name | Oxetan-2-ylmethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 383.817ºC at 760 mmHg |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.29100 |
| Flash Point | 185.926ºC |
| Exact Mass | 242.06100 |
| PSA | 60.98000 |
| LogP | 2.57000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | UYSILSHSVRRBST-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCO2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
|
~73%
oxetan-2-ylmeth... CAS#:115845-51-7 |
| Literature: Fitton, Alan O.; Hill, John; Jane, David E.; Millar, Ross Synthesis, 1987 , # 12 p. 1140 - 1142 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| oxetan-2-ylmethyl 4-methylbenzenesulfonate |