Methyl 2-[methyl(4-pyridinyl)carbamothioylthio]propionate structure
|
Common Name | Methyl 2-[methyl(4-pyridinyl)carbamothioylthio]propionate | ||
|---|---|---|---|---|
| CAS Number | 1158958-92-9 | Molecular Weight | 270.37100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O2S2 | Melting Point | 76-81 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | methyl 2-[methyl(pyridin-4-yl)carbamothioyl]sulfanylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 76-81 °C |
|---|---|
| Molecular Formula | C11H14N2O2S2 |
| Molecular Weight | 270.37100 |
| Exact Mass | 270.05000 |
| PSA | 99.82000 |
| LogP | 2.09740 |
| InChIKey | LOGGAKBRSDSFSB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)SC(=S)N(C)c1ccncc1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38-43 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
|
Universal (switchable) RAFT agents.
Material Matters 5 , 2, (2010) The polymerization of most monomers that are polymerizable by radical polymerization can be controlled by the reversible addition-fragmentation chain transfer (RAFT) process. However, it is usually re... |
|
|
RAFT Agent Design and Synthesis Keddie, D. J.; et al.
Macromolecules 45 , 5321-5342, (2012)
|
|
|
Polystyrene-block-poly(vinyl acetate) through the Use of a Switchable RAFT Agent Benaglia, M; Chen, M.; Chong, Y.K.; Moad, G.; Rizzardo, E.; Thang, S.H.
Macromolecules 42 , 9384, (2009)
|
| Methyl 2-[methyl(4-pyridinyl)carbamothioylthio]propionate |