N,N′-Dimethyl N,N′-di(4-pyridinyl)thiuram disulfide structure
|
Common Name | N,N′-Dimethyl N,N′-di(4-pyridinyl)thiuram disulfide | ||
|---|---|---|---|---|
| CAS Number | 1158958-94-1 | Molecular Weight | 366.54800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N4S4 | Melting Point | 118-128 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [methyl(pyridin-4-yl)carbamothioyl]sulfanyl N-methyl-N-pyridin-4-ylcarbamodithioate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 118-128 °C |
|---|---|
| Molecular Formula | C14H14N4S4 |
| Molecular Weight | 366.54800 |
| Exact Mass | 366.01000 |
| PSA | 147.04000 |
| LogP | 4.00040 |
| InChIKey | PVZGPMRTEJHLMS-UHFFFAOYSA-N |
| SMILES | CN(C(=S)SSC(=S)N(C)c1ccncc1)c1ccncc1 |
|
~73%
N,N′-Dimethyl N... CAS#:1158958-94-1 |
| Literature: Skouta, Rachid; Wei, Sujun; Breslow, Ronald Journal of the American Chemical Society, 2009 , vol. 131, # 43 p. 15604 - 15605 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Universal (switchable) RAFT agents.
Material Matters 5 , 2, (2010) The polymerization of most monomers that are polymerizable by radical polymerization can be controlled by the reversible addition-fragmentation chain transfer (RAFT) process. However, it is usually re... |
|
|
RAFT Agent Design and Synthesis Keddie, D. J.; et al.
Macromolecules 45 , 5321-5342, (2012)
|
| MFCD19687019 |