Tris(4-chlorophenyl)phosphine structure
|
Common Name | Tris(4-chlorophenyl)phosphine | ||
|---|---|---|---|---|
| CAS Number | 1159-54-2 | Molecular Weight | 365.621 | |
| Density | N/A | Boiling Point | 427.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C18H12Cl3P | Melting Point | 100-103 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 212.4±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tris(4-chlorophenyl)phosphine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 427.6±40.0 °C at 760 mmHg |
|---|---|
| Melting Point | 100-103 °C(lit.) |
| Molecular Formula | C18H12Cl3P |
| Molecular Weight | 365.621 |
| Flash Point | 212.4±27.3 °C |
| Exact Mass | 363.974213 |
| PSA | 13.59000 |
| LogP | 7.47 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| InChIKey | IQKSLJOIKWOGIZ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(P(c2ccc(Cl)cc2)c2ccc(Cl)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | 3278 |
| WGK Germany | 3 |
| Packaging Group | III |
| HS Code | 2903999090 |
|
~98%
Tris(4-chloroph... CAS#:1159-54-2 |
| Literature: CHROMAFORA AB; LAVEN, Gaston; KULLBERG, Martin Patent: WO2011/123037 A1, 2011 ; Location in patent: Page/Page column 23-24 ; |
|
~66%
Tris(4-chloroph... CAS#:1159-54-2 |
| Literature: Zhang, Qiang; Yang, Yanqin; Zhang, Suobo Chemistry - A European Journal, 2013 , vol. 19, # 30 p. 10024 - 10029 |
|
~34%
Tris(4-chloroph... CAS#:1159-54-2 |
| Literature: Le Gall, Erwan; Ben Aissi, Karima; Lachaise, Isabelle; Troupel, Michel Synlett, 2006 , # 6 p. 954 - 956 |
|
~%
Tris(4-chloroph... CAS#:1159-54-2 |
| Literature: Journal of the Chemical Society, , p. 527,530 |
|
~%
Tris(4-chloroph... CAS#:1159-54-2 |
| Literature: Polyhedron, , vol. 8, p. 167 - 174 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00013639 |
| Tris(p-chlorophenyl)phosphine |
| tris(4-chlorophenyl)phosphane |
| Tris(4-chlorophenyl)phosphine |
| EINECS 214-596-7 |
| Phosphine, tris(4-chlorophenyl)- |