2-Propen-1-one,1-(3-bromo-2-hydroxy-4,6-dimethoxyphenyl)-3-phenyl- structure
|
Common Name | 2-Propen-1-one,1-(3-bromo-2-hydroxy-4,6-dimethoxyphenyl)-3-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1159-57-5 | Molecular Weight | 363.20300 | |
| Density | 1.438g/cm3 | Boiling Point | 529.7ºC at 760mmHg | |
| Molecular Formula | C17H15BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.2ºC | |
| Name | (E)-1-(3-bromo-2-hydroxy-4,6-dimethoxyphenyl)-3-phenylprop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.438g/cm3 |
|---|---|
| Boiling Point | 529.7ºC at 760mmHg |
| Molecular Formula | C17H15BrO4 |
| Molecular Weight | 363.20300 |
| Flash Point | 274.2ºC |
| Exact Mass | 362.01500 |
| PSA | 55.76000 |
| LogP | 4.06800 |
| Vapour Pressure | 7.76E-12mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | SMCXTJBQMQBLHX-CMDGGOBGSA-N |
| SMILES | COc1cc(OC)c(C(=O)C=Cc2ccccc2)c(O)c1Br |
|
~73%
2-Propen-1-one,... CAS#:1159-57-5 |
| Literature: Cechinel-Filho; Vaz; Zunino; Calixto; Yunes European Journal of Medicinal Chemistry, 1996 , vol. 31, # 10 p. 833 - 839 |
|
~%
2-Propen-1-one,... CAS#:1159-57-5 |
| Literature: Cechinel-Filho; Vaz; Zunino; Calixto; Yunes European Journal of Medicinal Chemistry, 1996 , vol. 31, # 10 p. 833 - 839 |
|
~18%
2-Propen-1-one,... CAS#:1159-57-5 |
| Literature: Donnely, John A.; Quigley, Killian Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1980 , p. 1299 - 1305 |
| 3'-bromo-2'-hydroxy-4',6'-dimethoxychalcone |
| 3-Brom-4-hydroxy-1,1,2,2-tetramethyl-cyclopenten-(3)-on-(5) |
| 3-Brom-2-hydroxy-4,4,5,5-tetramethyl-cyclopent-2-en-1-on |
| Bromo-2-hydroxy-4,4,5,5-tetramethylcyclopenten-3-one |
| 3-bromo-2-hydroxy-4,4,5,5-tetramethylcyclopent-2-enone |
| 1-(3-bromo-4,6-dimethoxy-2-hydroxyphenyl)-3-phenyl-2-propen-1-one |
| 3-Brom-2-hydroxy-4,4,5,5-tetramethyl-cyclopenten-(2)-on-(1) |
| 3-bromo-2-hydroxy-4,4,5,5-tetramethylcyclopenta-2-enone |