Angoroside C structure
|
Common Name | Angoroside C | ||
|---|---|---|---|---|
| CAS Number | 115909-22-3 | Molecular Weight | 784.755 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 985.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C36H48O19 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.7±27.8 °C | |
Use of Angoroside CAngoroside C, a phenylpropanoid glycoside isolated from Radix Scrophulariae, has beneficial effects against ventricular remodeling[1]. |
| Name | Angoroside C |
|---|---|
| Synonym | More Synonyms |
| Description | Angoroside C, a phenylpropanoid glycoside isolated from Radix Scrophulariae, has beneficial effects against ventricular remodeling[1]. |
|---|---|
| Related Catalog | |
| In Vivo | Angoroside C has beneficial effects against ventricular remodeling. The mechanism is likely to be related to decreasing the level of Ang Ⅱ, attenuating the mRNA expressions of ET-1 and TGF-β1[1]. |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 985.7±65.0 °C at 760 mmHg |
| Molecular Formula | C36H48O19 |
| Molecular Weight | 784.755 |
| Flash Point | 301.7±27.8 °C |
| Exact Mass | 784.278992 |
| PSA | 282.21000 |
| LogP | 2.66 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | KLQXMRBGMLHBBQ-DQTDZZOCSA-N |
| SMILES | COc1ccc(CCOC2OC(COC3OCC(O)C(O)C3O)C(OC(=O)C=Cc3ccc(O)c(OC)c3)C(OC3OC(C)C(O)C(O)C3O)C2O)cc1O |
| Hazard Codes | Xn |
|---|
| β-D-Glucopyranoside, 2-(3-hydroxy-4-methoxyphenyl)ethyl O-α-L-arabinopyranosyl-(1->6)-O-[6-deoxy-α-L-talopyranosyl-(1->3)]-4-O-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-1-oxo-2-propen-1-yl]- |
| 2-(3-Hydroxy-4-methoxyphenyl)ethyl α-L-arabinopyranosyl-(1->6)-[6-deoxy-α-L-talopyranosyl-(1->3)]-4-O-[(2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propenoyl]-β-D-glucopyranoside |
| Angoroside C |
| 2-(3-Hydroxy-4-methoxyphenyl)ethyl α-L-arabinopyranosyl-(1->6)-[6-deoxy-α-L-talopyranosyl-(1->3)]-4-O-[(2E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]-β-D-glucopyranoside |
| Angoroside |