5-(4-Fluorophenyl)-2-thiophenecarboxylic acid structure
|
Common Name | 5-(4-Fluorophenyl)-2-thiophenecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 115933-30-7 | Molecular Weight | 222.23500 | |
| Density | 1.38g/cm3 | Boiling Point | 389.6ºC at 760mmHg | |
| Molecular Formula | C11H7FO2S | Melting Point | 250-254ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 189.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-(4-Fluorophenyl)thiophene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 389.6ºC at 760mmHg |
| Melting Point | 250-254ºC(lit.) |
| Molecular Formula | C11H7FO2S |
| Molecular Weight | 222.23500 |
| Flash Point | 189.4ºC |
| Exact Mass | 222.01500 |
| PSA | 65.54000 |
| LogP | 3.25240 |
| Vapour Pressure | 9.09E-07mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | YOFXYDVYMHOXSY-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccc(F)cc2)s1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
|
~99%
5-(4-Fluorophen... CAS#:115933-30-7 |
| Literature: Fujisawa Pharmaceutical Co., Ltd. Patent: US6770667 B1, 2004 ; Location in patent: Page column 13 ; |
|
~92%
5-(4-Fluorophen... CAS#:115933-30-7 |
| Literature: Nemoto, Koji; Onozawa, Satoru; Konno, Megumi; Morohashi, Naoya; Hattori, Tetsutaro Bulletin of the Chemical Society of Japan, 2012 , vol. 85, # 3 p. 369 - 371 |
|
~%
5-(4-Fluorophen... CAS#:115933-30-7 |
| Literature: WO2012/59443 A2, ; WO 2012/059443 A2 |
|
~%
5-(4-Fluorophen... CAS#:115933-30-7 |
| Literature: WO2012/59443 A2, ; WO 2012/059443 A2 |
| 5-(4-Fluorophenyl)-2-thiophenecarboxylic acid |
| 5-(4-fluorophenyl)thiophene-2-carboxylic acid |
| MFCD01316570 |