2-Bromo-3-fluoro-6-(trifluoromethyl)pyridine structure
|
Common Name | 2-Bromo-3-fluoro-6-(trifluoromethyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 1159512-38-5 | Molecular Weight | 243.984 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 153.1±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H2BrF4N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 46.4±25.9 °C | |
| Name | 2-Bromo-3-fluoro-6-(trifluoromethyl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 153.1±35.0 °C at 760 mmHg |
| Molecular Formula | C6H2BrF4N |
| Molecular Weight | 243.984 |
| Flash Point | 46.4±25.9 °C |
| Exact Mass | 242.930664 |
| PSA | 12.89000 |
| LogP | 2.26 |
| Vapour Pressure | 4.3±0.3 mmHg at 25°C |
| Index of Refraction | 1.454 |
| InChIKey | SJOPTDNFZAGRFI-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1F)Br)C(F)(F)F |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine, 2-bromo-3-fluoro-6-(trifluoromethyl)- |
| 2-Bromo-3-fluoro-6-(trifluoromethyl)pyridine |