3-(Dimethylamino)-1-(3-nitrophenyl)prop-2-en-1-one structure
|
Common Name | 3-(Dimethylamino)-1-(3-nitrophenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 115955-48-1 | Molecular Weight | 220.225 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 341.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.3±27.9 °C | |
| Name | 3-(dimethylamino)-1-(3-nitrophenyl)-2-propen-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 341.4±42.0 °C at 760 mmHg |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.225 |
| Flash Point | 160.3±27.9 °C |
| Exact Mass | 220.084793 |
| PSA | 66.13000 |
| LogP | 2.21 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | CNGBILRLACOBKO-UHFFFAOYSA-N |
| SMILES | CN(C)C=CC(=O)c1cccc([N+](=O)[O-])c1 |
| HS Code | 2922399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Propen-1-one, 3-(dimethylamino)-1-(3-nitrophenyl)-, (2E)- |
| 3-(dimethylamino)-1-(3-nitrophenyl)prop-2-en-1-one |
| (2E)-3-(Dimethylamino)-1-(3-nitrophenyl)-2-propen-1-one |
| (2E)-3-(Dimethylamino)-1-(3-nitrophenyl)prop-2-en-1-one |