Edrophonium chloride structure
|
Common Name | Edrophonium chloride | ||
|---|---|---|---|---|
| CAS Number | 116-38-1 | Molecular Weight | 201.693 | |
| Density | 1.395 g/mL at 25 °C(lit.) | Boiling Point | 130 °C20 mm Hg(lit.) | |
| Molecular Formula | C10H16ClNO | Melting Point | 162-163°C | |
| MSDS | N/A | Flash Point | >230 °F | |
Use of Edrophonium chlorideEdrophonium chloride is a readily reversible acetylcholinesterase inhibitor; prevents breakdown of the neurotransmitter acetylcholine and acts by competitively inhibiting the enzyme acetylcholinesterase, mainly at the neuromuscular junction. |
| Name | edrophonium chloride |
|---|---|
| Synonym | More Synonyms |
| Description | Edrophonium chloride is a readily reversible acetylcholinesterase inhibitor; prevents breakdown of the neurotransmitter acetylcholine and acts by competitively inhibiting the enzyme acetylcholinesterase, mainly at the neuromuscular junction. |
|---|---|
| Related Catalog |
| Density | 1.395 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 130 °C20 mm Hg(lit.) |
| Melting Point | 162-163°C |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.693 |
| Flash Point | >230 °F |
| Exact Mass | 201.092041 |
| PSA | 20.23000 |
| Index of Refraction | n20/D 1.486(lit.) |
| InChIKey | BXKDSDJJOVIHMX-UHFFFAOYSA-N |
| SMILES | CC[N+](C)(C)c1cccc(O)c1.[Cl-] |
| Storage condition | 2-8°C |
| Water Solubility | reacts |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | BQ5870000 |
| HS Code | 2923900090 |
|
~%
Edrophonium chloride CAS#:116-38-1 |
| Literature: DE837098 , ; DRP/DRBP Org.Chem. |
|
~%
Edrophonium chloride CAS#:116-38-1 |
| Literature: DE837098 , ; DRP/DRBP Org.Chem. |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| edrophonium chloride |
| MFCD00055064 |
| EINECS 204-138-4 |
| Benzenaminium, N-ethyl-3-hydroxy-N,N-dimethyl-, chloride (1:1) |
| N-Ethyl-3-hydroxy-N,N-dimethylbenzenaminium chloride |
| Ethyl(m-hydroxyphenyl)dimethylammonium chloride |
| Tensilon |
| N-Ethyl-3-hydroxy-N,N-dimethylanilinium chloride |
| ethyl-(3-hydroxyphenyl)-dimethylazanium,chloride |
| Edrophonium (chloride) |