4-(4-aminophenyl)aniline,2-methylphenol
Modify Date: 2025-11-07 17:05:14
4-(4-aminophenyl)aniline,2-methylphenol structure
|
Common Name | 4-(4-aminophenyl)aniline,2-methylphenol | ||
|---|---|---|---|---|
| CAS Number | 116030-76-3 | Molecular Weight | 292.37500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-aminophenyl)aniline,2-methylphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H20N2O |
|---|---|
| Molecular Weight | 292.37500 |
| Exact Mass | 292.15800 |
| PSA | 72.27000 |
| LogP | 5.38100 |
| InChIKey | NRFTYXPBPGGKHT-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1O.Nc1ccc(-c2ccc(N)cc2)cc1 |
| HS Code | 2921590090 |
|---|
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzidine compound with o-cresol (1:1) |