RETF-4NA TFA structure
|
Common Name | RETF-4NA TFA | ||
|---|---|---|---|---|
| CAS Number | 1160928-63-1 | Molecular Weight | 713.73800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H43N9O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RETF-4NA TFARETF-4NA, a chymase-specific substrate, is a sensitive and selective substrate for chymase when free or bound to α2M[1][2]. |
| Name | N2-Acetyl-L-arginyl-L-α-glutamyl-L-threonyl-N-(4-nitrophenyl)-L-phenylalaninamide |
|---|
| Description | RETF-4NA, a chymase-specific substrate, is a sensitive and selective substrate for chymase when free or bound to α2M[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C32H43N9O10 |
|---|---|
| Molecular Weight | 713.73800 |
| Exact Mass | 713.31300 |
| PSA | 324.71000 |
| LogP | 4.39230 |
| InChIKey | MGCWUIJMQAZRNY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CCCN=C(N)N)C(=O)NC(CCC(=O)O)C(=O)NC(C(=O)NC(Cc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1)C(C)O |