Ethanedioic acid,1,2-bis(2,4-dichlorophenyl) ester structure
|
Common Name | Ethanedioic acid,1,2-bis(2,4-dichlorophenyl) ester | ||
|---|---|---|---|---|
| CAS Number | 1161-08-6 | Molecular Weight | 380.00700 | |
| Density | 1.58 g/cm3 | Boiling Point | 451.9ºC at 760 mmHg | |
| Molecular Formula | C14H6Cl4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.4ºC | |
| Name | bis(2,4-dichlorophenyl) oxalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.58 g/cm3 |
|---|---|
| Boiling Point | 451.9ºC at 760 mmHg |
| Molecular Formula | C14H6Cl4O4 |
| Molecular Weight | 380.00700 |
| Flash Point | 176.4ºC |
| Exact Mass | 377.90200 |
| PSA | 52.60000 |
| LogP | 4.81120 |
| Vapour Pressure | 2.34E-08mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | RGANGUYEXJUJML-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(Cl)cc1Cl)C(=O)Oc1ccc(Cl)cc1Cl |
| HS Code | 2917119000 |
|---|
| HS Code | 2917119000 |
|---|---|
| Summary | 2917119000 oxalic acid salts and esters VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| bis(2,4-dichlorophenyl) ethanedioate |
| Oxalsaeure-bis-(2,4-dichlor-phenylester) |
| Bis-<2,4-dichloro-phenyl>-oxalat |