(R)-2-Benzyl-succinic acid 1-benzyl ester
(R)-2-Benzyl-succinic acid 1-benzyl ester structure
|
Common Name | (R)-2-Benzyl-succinic acid 1-benzyl ester | ||
|---|---|---|---|---|
| CAS Number | 116129-80-7 | Molecular Weight | 298.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (r)-2-benzyl-succinic acid 1-benzyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H18O4 |
|---|---|
| Molecular Weight | 298.33300 |
| Exact Mass | 298.12100 |
| PSA | 63.60000 |
| LogP | 3.06340 |
| InChIKey | ZXEOHROMGBZHPE-MRXNPFEDSA-N |
| SMILES | O=C(O)CC(Cc1ccccc1)C(=O)OCc1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (3R)-3-Benzyloxycarbonyl-3-phenylmethylpropionic acid |
| benzyl (2R)-3-Carboxy-2-benzylpropionate |
| benzyl (2-oxocyclohexyl)carbamate |
| benzyl (2R)-2-(carboxymethyl)-3-phenyl-propionate |
| 1-Azetidineacetic acid,2-oxo-,phenylmethyl ester |
| 2R-(Phenylmethyl)butanedioic acid |
| benzyl 2-azetidinone-N-ethanoate |
| benzyl (2-oxoazetidin-1-yl)acetate |
| (+/-)-2-<N-(benzyloxycarbonyl)amino>cyclohexanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (r)-2-benzyl-succinic acid 1-benzyl ester? |
| A: Molecular formula of (r)-2-benzyl-succinic acid 1-benzyl ester is C18H18O4. |
| Q: What is the InChIKey of (r)-2-benzyl-succinic acid 1-benzyl ester? |
| A: InChIKey of (r)-2-benzyl-succinic acid 1-benzyl ester is ZXEOHROMGBZHPE-MRXNPFEDSA-N. |
| Q: What is the LogP of (r)-2-benzyl-succinic acid 1-benzyl ester? |
| A: LogP of (r)-2-benzyl-succinic acid 1-benzyl ester is 3.06340. |
| Q: What are the upstream materials of (r)-2-benzyl-succinic acid 1-benzyl ester? |
| A: Related upstream materials(CAS) of (r)-2-benzyl-succinic acid 1-benzyl ester: 116129-88-5;76-05-1;645-45-4;136159-65-4. |
| Q: What is the SMILES notation of (r)-2-benzyl-succinic acid 1-benzyl ester? |
| A: SMILES notation of (r)-2-benzyl-succinic acid 1-benzyl ester is O=C(O)CC(Cc1ccccc1)C(=O)OCc1ccccc1. |
| Q: What is the polar surface area (PSA) of (r)-2-benzyl-succinic acid 1-benzyl ester? |
| A: Polar surface area (PSA) of (r)-2-benzyl-succinic acid 1-benzyl ester is 63.60000. |
| Q: What English synonyms does (r)-2-benzyl-succinic acid 1-benzyl ester have? |
| A: English synonyms of (r)-2-benzyl-succinic acid 1-benzyl ester: (3R)-3-Benzyloxycarbonyl-3-phenylmethylpropionic acid, benzyl (2R)-3-Carboxy-2-benzylpropionate, benzyl (2-oxocyclohexyl)carbamate, benzyl (2R)-2-(carboxymethyl)-3-phenyl-propionate, 1-Azetidineacetic acid,2-oxo-,phenylmethyl ester, 2R-(Phenylmethyl)butanedioic acid, benzyl 2-azetidinone-N-ethanoate, benzyl (2-oxoazetidin-1-yl)acetate, (+/-)-2-cyclohexanone. |
| Q: What is the English name of (r)-2-benzyl-succinic acid 1-benzyl ester? |
| A: The English name of (r)-2-benzyl-succinic acid 1-benzyl ester is (r)-2-benzyl-succinic acid 1-benzyl ester. |
| Q: What is the CAS number of (r)-2-benzyl-succinic acid 1-benzyl ester? |
| A: CAS number of (r)-2-benzyl-succinic acid 1-benzyl ester is 116129-80-7. |
| Q: What is the Chinese name of 116129-80-7? |
| A: Chinese name of 116129-80-7 is 116129-80-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |