(4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone
(4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone structure
|
Common Name | (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone | ||
|---|---|---|---|---|
| CAS Number | 136159-65-4 | Molecular Weight | 309.35900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone, also known as CAS 136159-65-4, has a molecular formula of C19H19NO3 and a molecular weight of 309.35900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H19NO3 |
|---|---|
| Molecular Weight | 309.35900 |
| Exact Mass | 309.13600 |
| PSA | 46.61000 |
| LogP | 3.14720 |
| InChIKey | CDSPCWKYSYEPMH-QGZVFWFLSA-N |
| SMILES | O=C(CCc1ccccc1)N1C(=O)OCC1Cc1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 6 | |
CAS#:122-97-4
CAS#:673-06-3
CAS#:122225-33-6
CAS#:17698-11-2
CAS#:116129-80-7
CAS#:116129-88-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(3--phenyl-1--oxopropyl)-4(S)-(phenylmethyl)-2-oxazolidinone |
| (4S)-4-benzyl-3-(3-phenyl-1-oxopropyl)-2-oxazolidinone |
| (S)-3-(3-phenylpropanoyl)-4-benzyloxazolidin-2-one |
| (S)-4-benzyl-3-(3-phenylpropanoyl)oxazolidin-2-one |
| (S)-3-(3-phenylpropionyl)-4-benzyloxazolidin-2-one |
| 4-benzyl-3-(3-phenylpropanoyl)-1,3-oxazolidin-2-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone? |
| A: Related downstream products(CAS) of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone: 122-97-4;673-06-3;122225-33-6;17698-11-2;116129-80-7;116129-88-5. |
| Q: What is the molecular weight of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone? |
| A: Molecular weight of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone is 309.35900. |
| Q: What is the LogP of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone? |
| A: LogP of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone is 3.14720. |
| Q: What English synonyms does (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone have? |
| A: English synonyms of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone: 3-(3--phenyl-1--oxopropyl)-4(S)-(phenylmethyl)-2-oxazolidinone, (4S)-4-benzyl-3-(3-phenyl-1-oxopropyl)-2-oxazolidinone, (S)-3-(3-phenylpropanoyl)-4-benzyloxazolidin-2-one, (S)-4-benzyl-3-(3-phenylpropanoyl)oxazolidin-2-one, (S)-3-(3-phenylpropionyl)-4-benzyloxazolidin-2-one, 4-benzyl-3-(3-phenylpropanoyl)-1,3-oxazolidin-2-one. |
| Q: What is the InChIKey of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone? |
| A: InChIKey of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone is CDSPCWKYSYEPMH-QGZVFWFLSA-N. |
| Q: What is the molecular formula of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone? |
| A: Molecular formula of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone is C19H19NO3. |
| Q: What is the CAS number of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone? |
| A: CAS number of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone is 136159-65-4. |
| Q: What is the English name of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone? |
| A: The English name of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone is (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone. |
| Q: What is the Chinese name of 136159-65-4? |
| A: Chinese name of 136159-65-4 is 136159-65-4. |
| Q: What is the SMILES notation of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone? |
| A: SMILES notation of (4S)-3-(3-phenyl-1-oxopropyl)-4-phenylmethyl-2-oxazolidinone is O=C(CCc1ccccc1)N1C(=O)OCC1Cc1ccccc1. |