[3-Bromo-5-(trifluoromethyl)phenyl]acetic acid structure
|
Common Name | [3-Bromo-5-(trifluoromethyl)phenyl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 1161362-01-1 | Molecular Weight | 283.042 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 297.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C9H6BrF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 133.8±25.9 °C | |
| Name | 3-Bromo-5-(Trifluoromethyl)Phenylacetic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 297.6±35.0 °C at 760 mmHg |
| Molecular Formula | C9H6BrF3O2 |
| Molecular Weight | 283.042 |
| Flash Point | 133.8±25.9 °C |
| Exact Mass | 281.950317 |
| PSA | 37.30000 |
| LogP | 2.54 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | POLZAYSCKXDHKM-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cc(Br)cc(C(F)(F)F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
|
~%
[3-Bromo-5-(tri... CAS#:1161362-01-1 |
| Literature: WO2009/75874 A1, ; Page/Page column 103-104 ; WO 2009/075874 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| [3-Bromo-5-(trifluoromethyl)phenyl]acetic acid |
| Benzeneacetic acid, 3-bromo-5-(trifluoromethyl)- |
| 3-Bromo-5-(trifluoromethyl)phenylacetic acid |
| 2-[3-bromo-5-(trifluoromethyl)phenyl]acetic acid |