5-(FURAN-2-YL)-4H-PYRAZOLE-3-CARBOXYLIC ACID
5-(FURAN-2-YL)-4H-PYRAZOLE-3-CARBOXYLIC ACID structure
|
Common Name | 5-(FURAN-2-YL)-4H-PYRAZOLE-3-CARBOXYLIC ACID | ||
|---|---|---|---|---|
| CAS Number | 116153-81-2 | Molecular Weight | 178.14500 | |
| Density | 1.465g/cm3 | Boiling Point | 488ºC at 760mmHg | |
| Molecular Formula | C8H6N2O3 | Melting Point | 216-218ºC | |
| MSDS | USA | Flash Point | 248.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2-furyl)-4h-pyrazole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.465g/cm3 |
|---|---|
| Boiling Point | 488ºC at 760mmHg |
| Melting Point | 216-218ºC |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.14500 |
| Flash Point | 248.9ºC |
| Exact Mass | 178.03800 |
| PSA | 79.12000 |
| LogP | 1.36790 |
| Vapour Pressure | 2.45E-10mmHg at 25°C |
| Index of Refraction | 1.617 |
| InChIKey | GKPSFQIKCROJOB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2ccco2)[nH]n1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~73%
5-(FURAN-2-YL)-... CAS#:116153-81-2 |
| Literature: Ermolenko, Mikhail S.; Guillou, Sandrine; Janin, Yves L. Tetrahedron, 2013 , vol. 69, # 1 p. 257 - 263 |
|
~%
5-(FURAN-2-YL)-... CAS#:116153-81-2 |
| Literature: Tetrahedron, , vol. 69, # 1 p. 257 - 263 |
|
~%
5-(FURAN-2-YL)-... CAS#:116153-81-2
Learn More
|
| Literature: Heterocycles, , vol. 85, # 2 p. 431 - 439 |
|
~%
5-(FURAN-2-YL)-... CAS#:116153-81-2 |
| Literature: Gazzetta Chimica Italiana, , vol. 88, p. 879,896 |
|
~%
5-(FURAN-2-YL)-... CAS#:116153-81-2 |
| Literature: Gazzetta Chimica Italiana, , vol. 88, p. 879,896 |
|
~%
5-(FURAN-2-YL)-... CAS#:116153-81-2 |
| Literature: Gazzetta Chimica Italiana, , vol. 88, p. 879,896 |
|
~%
5-(FURAN-2-YL)-... CAS#:116153-81-2 |
| Literature: Gazzetta Chimica Italiana, , vol. 88, p. 879,896 |
![4-[2]furyl-4-oxo-2-semicarbazono-butyric acid ethyl ester structure](https://image.chemsrc.com/caspic/472/100128-38-9.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-(Furan-2-yl)-2H-pyrazole-3-carboxylic acid |
| 5-(Furan-2-yl)-1H-pyrazol-3-carboxylic acid |
| 5-(Furan-2-yl)-4H-pyrazole-3-carboxylic acid |
| 5-(2-FURYL)-1H-PYRAZOLE-3-CARBOXYLIC ACID |
| 5-(furan-2-yl)-1H-pyrazole-3-carboxylic acid |
| 5-[2]Furyl-1(2)H-pyrazol-3-carbonsaeure |
| 5-[2]furyl-1(2)H-pyrazole-3-carboxylic acid |
| 5-Fur-2-yl-1H-pyrazole-3-carboxylic acid |
| 5-(2-FURYL)PYRAZOLE-3-CARBOXYLIC ACID |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid? |
| A: Molecular weight of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid is 178.14500. |
| Q: What is the melting point of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid? |
| A: Melting point of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid is 216-218ºC. |
| Q: What is the molecular formula of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid? |
| A: Molecular formula of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid is C8H6N2O3. |
| Q: What is the SMILES notation of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid? |
| A: SMILES notation of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid is O=C(O)c1cc(-c2ccco2)[nH]n1. |
| Q: What is the CAS number of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid? |
| A: CAS number of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid is 116153-81-2. |
| Q: What is the English name of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid? |
| A: The English name of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid is 5-(2-furyl)-4h-pyrazole-3-carboxylic acid. |
| Q: What English synonyms does 5-(2-furyl)-4h-pyrazole-3-carboxylic acid have? |
| A: English synonyms of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid: 5-(Furan-2-yl)-2H-pyrazole-3-carboxylic acid, 5-(Furan-2-yl)-1H-pyrazol-3-carboxylic acid, 5-(Furan-2-yl)-4H-pyrazole-3-carboxylic acid, 5-(2-FURYL)-1H-PYRAZOLE-3-CARBOXYLIC ACID, 5-(furan-2-yl)-1H-pyrazole-3-carboxylic acid, 5-[2]Furyl-1(2)H-pyrazol-3-carbonsaeure, 5-[2]furyl-1(2)H-pyrazole-3-carboxylic acid, 5-Fur-2-yl-1H-pyrazole-3-carboxylic acid, 5-(2-FURYL)PYRAZOLE-3-CARBOXYLIC ACID. |
| Q: What is the InChIKey of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid? |
| A: InChIKey of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid is GKPSFQIKCROJOB-UHFFFAOYSA-N. |
| Q: What is the LogP of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid? |
| A: LogP of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid is 1.36790. |
| Q: What is the boiling point of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid? |
| A: Boiling point of 5-(2-furyl)-4h-pyrazole-3-carboxylic acid is 488ºC at 760mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |