4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one
4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one structure
|
Common Name | 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one | ||
|---|---|---|---|---|
| CAS Number | 116296-75-4 | Molecular Weight | 208.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one, Chinese name is 4-(4-羟基-2,6,6-三甲基环己烯-1-基)丁-3-烯-2-酮, CAS number is 116296-75-4, molecular formula is C13H20O2, molecular weight is 208.29700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H20O2 |
|---|---|
| Molecular Weight | 208.29700 |
| Exact Mass | 208.14600 |
| PSA | 37.30000 |
| LogP | 2.62900 |
| InChIKey | HFRZSVYKDDZRQY-UHFFFAOYSA-N |
| SMILES | CC(=O)C=CC1=C(C)CC(O)CC1(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:472-70-8
CAS#:1200446-88-3This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one? |
| A: Related downstream products(CAS) of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one: 472-70-8;1200446-88-3. |
| Q: What is the polar surface area (PSA) of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one? |
| A: Polar surface area (PSA) of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one is 37.30000. |
| Q: What is the English name of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one? |
| A: The English name of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one is 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one. |
| Q: What is the LogP of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one? |
| A: LogP of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one is 2.62900. |
| Q: What is the molecular formula of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one? |
| A: Molecular formula of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one is C13H20O2. |
| Q: What is the InChIKey of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one? |
| A: InChIKey of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one is HFRZSVYKDDZRQY-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one? |
| A: SMILES notation of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one is CC(=O)C=CC1=C(C)CC(O)CC1(C)C. |
| Q: What is the Chinese name of 116296-75-4? |
| A: Chinese name of 116296-75-4 is 116296-75-4. |
| Q: What is the molecular weight of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one? |
| A: Molecular weight of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one is 208.29700. |
| Q: What is the CAS number of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one? |
| A: CAS number of 4-(4-hydroxy-2,6,6-trimethylcyclohexen-1-yl)but-3-en-2-one is 116296-75-4. |