2-(2-chlorocyclohex-2-en-1-yl)isoindole-1,3-dione structure
|
Common Name | 2-(2-chlorocyclohex-2-en-1-yl)isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 116330-66-6 | Molecular Weight | 261.70400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-chlorocyclohex-2-en-1-yl)isoindole-1,3-dione |
|---|
| Molecular Formula | C14H12ClNO2 |
|---|---|
| Molecular Weight | 261.70400 |
| Exact Mass | 261.05600 |
| PSA | 37.38000 |
| LogP | 2.89570 |
| InChIKey | LVLKLPMPJPNEGV-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1C1CCCC=C1Cl |
|
~0%
2-(2-chlorocycl... CAS#:116330-66-6 |
| Literature: Merrell Dow Pharmaceuticals Inc. Patent: US4824832 A1, 1989 ; US 4824832 A |
|
~%
2-(2-chlorocycl... CAS#:116330-66-6 |
| Literature: Flynn, Gary A.; Giroux, Eugene L.; Dage, Richard C. Journal of the American Chemical Society, 1987 , vol. 109, # 25 p. 7914 - 7915 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |