7-acetyl-4-methyl-1,4-benzoxazin-3-one
7-acetyl-4-methyl-1,4-benzoxazin-3-one structure
|
Common Name | 7-acetyl-4-methyl-1,4-benzoxazin-3-one | ||
|---|---|---|---|---|
| CAS Number | 116337-71-4 | Molecular Weight | 205.21000 | |
| Density | 1.233g/cm3 | Boiling Point | 484ºC at 760mmHg | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.5ºC | |
Summary: 7-Acetyl-4-methyl-1,4-benzoxazin-3-one (CAS号：116337-71-4), molecular formula C11H11NO3, molecular weight 205.21. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-acetyl-4-methyl-1,4-benzoxazin-3-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 484ºC at 760mmHg |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21000 |
| Flash Point | 246.5ºC |
| Exact Mass | 205.07400 |
| PSA | 46.61000 |
| LogP | 1.30940 |
| Vapour Pressure | 1.6E-09mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | XTLDCEGIZIGZTI-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)OCC(=O)N2C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~72%
7-acetyl-4-meth... CAS#:116337-71-4 |
| Literature: Moussavi, Ziaeddine; Lesieur, Daniel; Lespagnol, Charles; Sauzieres, Jacques; Olivier, Philippe European Journal of Medicinal Chemistry, 1989 , vol. 24, p. 55 - 60 |
|
~%
7-acetyl-4-meth... CAS#:116337-71-4 |
| Literature: Moussavi, Ziaeddine; Lesieur, Daniel; Lespagnol, Charles; Sauzieres, Jacques; Olivier, Philippe European Journal of Medicinal Chemistry, 1989 , vol. 24, p. 55 - 60 |
|
~%
7-acetyl-4-meth... CAS#:116337-71-4 |
| Literature: Moussavi, Ziaeddine; Lesieur, Daniel; Lespagnol, Charles; Sauzieres, Jacques; Olivier, Philippe European Journal of Medicinal Chemistry, 1989 , vol. 24, p. 55 - 60 |
![1-[3-hydroxy-4-(methylamino)phenyl]ethanone structure](https://image.chemsrc.com/caspic/145/54903-57-0.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 7-acetyl-4-methyl-1,4-benzoxazin-3-one? |
| A: Polar surface area (PSA) of 7-acetyl-4-methyl-1,4-benzoxazin-3-one is 46.61000. |
| Q: What is the SMILES notation of 7-acetyl-4-methyl-1,4-benzoxazin-3-one? |
| A: SMILES notation of 7-acetyl-4-methyl-1,4-benzoxazin-3-one is CC(=O)c1ccc2c(c1)OCC(=O)N2C. |
| Q: What is the Chinese name of 116337-71-4? |
| A: Chinese name of 116337-71-4 is 116337-71-4. |
| Q: What is the boiling point of 7-acetyl-4-methyl-1,4-benzoxazin-3-one? |
| A: Boiling point of 7-acetyl-4-methyl-1,4-benzoxazin-3-one is 484ºC at 760mmHg. |
| Q: What is the molecular formula of 7-acetyl-4-methyl-1,4-benzoxazin-3-one? |
| A: Molecular formula of 7-acetyl-4-methyl-1,4-benzoxazin-3-one is C11H11NO3. |
| Q: What is the LogP of 7-acetyl-4-methyl-1,4-benzoxazin-3-one? |
| A: LogP of 7-acetyl-4-methyl-1,4-benzoxazin-3-one is 1.30940. |
| Q: What is the CAS number of 7-acetyl-4-methyl-1,4-benzoxazin-3-one? |
| A: CAS number of 7-acetyl-4-methyl-1,4-benzoxazin-3-one is 116337-71-4. |
| Q: What is the English name of 7-acetyl-4-methyl-1,4-benzoxazin-3-one? |
| A: The English name of 7-acetyl-4-methyl-1,4-benzoxazin-3-one is 7-acetyl-4-methyl-1,4-benzoxazin-3-one. |
| Q: What is the molecular weight of 7-acetyl-4-methyl-1,4-benzoxazin-3-one? |
| A: Molecular weight of 7-acetyl-4-methyl-1,4-benzoxazin-3-one is 205.21000. |
| Q: What is the InChIKey of 7-acetyl-4-methyl-1,4-benzoxazin-3-one? |
| A: InChIKey of 7-acetyl-4-methyl-1,4-benzoxazin-3-one is XTLDCEGIZIGZTI-UHFFFAOYSA-N. |