methyl 2-(5-fluoro-2-nitrophenoxy)acetate
methyl 2-(5-fluoro-2-nitrophenoxy)acetate structure
|
Common Name | methyl 2-(5-fluoro-2-nitrophenoxy)acetate | ||
|---|---|---|---|---|
| CAS Number | 116355-65-8 | Molecular Weight | 229.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8FNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Methyl 2-(5-fluoro-2-nitrophenoxy)acetate, Chinese name: 甲基5-氟-2-硝基苯氧乙酸酯, CAS number: 116355-65-8, molecular formula: C9H8FNO5, molecular weight: 229.16200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 2-(5-fluoro-2-nitrophenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8FNO5 |
|---|---|
| Molecular Weight | 229.16200 |
| Exact Mass | 229.03900 |
| PSA | 81.35000 |
| LogP | 1.80890 |
| InChIKey | ODNCCKAYVNDMJG-UHFFFAOYSA-N |
| SMILES | COC(=O)COc1cc(F)ccc1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~91%
methyl 2-(5-flu... CAS#:116355-65-8 |
| Literature: US5238908 A1, ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![7-Fluoro-2H-benzo[b][1,4]oxazin-3(4H)-one structure](https://image.chemsrc.com/caspic/123/103361-99-5.png)
CAS#:103361-99-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methyl 5-fluoro-2-nitrophenoxyacetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of methyl 2-(5-fluoro-2-nitrophenoxy)acetate? |
| A: SMILES notation of methyl 2-(5-fluoro-2-nitrophenoxy)acetate is COC(=O)COc1cc(F)ccc1[N+](=O)[O-]. |
| Q: What is the polar surface area (PSA) of methyl 2-(5-fluoro-2-nitrophenoxy)acetate? |
| A: Polar surface area (PSA) of methyl 2-(5-fluoro-2-nitrophenoxy)acetate is 81.35000. |
| Q: What is the LogP of methyl 2-(5-fluoro-2-nitrophenoxy)acetate? |
| A: LogP of methyl 2-(5-fluoro-2-nitrophenoxy)acetate is 1.80890. |
| Q: What is the InChIKey of methyl 2-(5-fluoro-2-nitrophenoxy)acetate? |
| A: InChIKey of methyl 2-(5-fluoro-2-nitrophenoxy)acetate is ODNCCKAYVNDMJG-UHFFFAOYSA-N. |
| Q: What is the English name of methyl 2-(5-fluoro-2-nitrophenoxy)acetate? |
| A: The English name of methyl 2-(5-fluoro-2-nitrophenoxy)acetate is methyl 2-(5-fluoro-2-nitrophenoxy)acetate. |
| Q: What English synonyms does methyl 2-(5-fluoro-2-nitrophenoxy)acetate have? |
| A: English synonyms of methyl 2-(5-fluoro-2-nitrophenoxy)acetate: methyl 5-fluoro-2-nitrophenoxyacetate. |
| Q: What is the CAS number of methyl 2-(5-fluoro-2-nitrophenoxy)acetate? |
| A: CAS number of methyl 2-(5-fluoro-2-nitrophenoxy)acetate is 116355-65-8. |
| Q: What is the molecular formula of methyl 2-(5-fluoro-2-nitrophenoxy)acetate? |
| A: Molecular formula of methyl 2-(5-fluoro-2-nitrophenoxy)acetate is C9H8FNO5. |
| Q: What are the downstream products of methyl 2-(5-fluoro-2-nitrophenoxy)acetate? |
| A: Related downstream products(CAS) of methyl 2-(5-fluoro-2-nitrophenoxy)acetate: 103361-99-5. |
| Q: What is the Chinese name of 116355-65-8? |
| A: Chinese name of 116355-65-8 is 116355-65-8. |