2-azido-N-(2-methylphenyl)acetamide structure
|
Common Name | 2-azido-N-(2-methylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 116433-48-8 | Molecular Weight | 190.20200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-azido-N-(2-methylphenyl)acetamide |
|---|
| Molecular Formula | C9H10N4O |
|---|---|
| Molecular Weight | 190.20200 |
| Exact Mass | 190.08500 |
| PSA | 82.34000 |
| LogP | 2.34606 |
| InChIKey | UUCMTJUHMSZPRC-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1NC(=O)CN=[N+]=[N-] |
|
~89%
2-azido-N-(2-me... CAS#:116433-48-8 |
| Literature: Ananthanarayanan, C.; Ramakrishnan, V. T. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 156 - 157 |
|
~%
2-azido-N-(2-me... CAS#:116433-48-8 |
| Literature: Ananthanarayanan, C.; Ramakrishnan, V. T. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 156 - 157 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |