2-azido-N-(4-methylphenyl)acetamide structure
|
Common Name | 2-azido-N-(4-methylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 116433-49-9 | Molecular Weight | 190.20200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-azido-N-(4-methylphenyl)acetamide |
|---|
| Molecular Formula | C9H10N4O |
|---|---|
| Molecular Weight | 190.20200 |
| Exact Mass | 190.08500 |
| PSA | 78.85000 |
| LogP | 1.76956 |
| InChIKey | CCDGBERUXHSSKZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)CN=[N+]=[N-])cc1 |
| HS Code | 2929909090 |
|---|
|
~84%
2-azido-N-(4-me... CAS#:116433-49-9 |
| Literature: Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, , vol. 27, # 1-12 p. 156 - 157 |
|
~%
2-azido-N-(4-me... CAS#:116433-49-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 24, # 3 p. 746 - 749 |
|
~%
2-azido-N-(4-me... CAS#:116433-49-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 24, # 3 p. 746 - 749 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2929909090 |
|---|---|
| Summary | 2929909090 other compounds with other nitrogen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |