2-(Trifluoromethoxy)benzylsulphonyl chloride structure
|
Common Name | 2-(Trifluoromethoxy)benzylsulphonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 116827-38-4 | Molecular Weight | 274.645 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 279.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H6ClF3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.9±27.3 °C | |
| Name | [2-(trifluoromethoxy)phenyl]methanesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 279.7±40.0 °C at 760 mmHg |
| Molecular Formula | C8H6ClF3O3S |
| Molecular Weight | 274.645 |
| Flash Point | 122.9±27.3 °C |
| Exact Mass | 273.967834 |
| PSA | 51.75000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.492 |
| InChIKey | BICRWGINZIMNCC-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)Cc1ccccc1OC(F)(F)F |
| HS Code | 2909309090 |
|---|
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzenemethanesulfonylchloride,2-(trifluoromethoxy) |
| (2-(Trifluoromethoxy)phenyl)methanesulfonyl chloride |
| 2-(Trifluoromethoxy)-benzenemethanesulfonyl chloride |
| 2-(Trifluoromethoxy)benzylsulphonyl chloride |
| [2-(Trifluoromethoxy)phenyl]methanesulfonyl chloride |
| Benzenemethanesulfonyl chloride, 2-(trifluoromethoxy)- |