2-(Trifluoromethoxy)benzenesulfonyl chloride structure
|
Common Name | 2-(Trifluoromethoxy)benzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 103008-51-1 | Molecular Weight | 260.618 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 262.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H4ClF3O3S | Melting Point | 27-31 °C(lit.) | |
| MSDS | Chinese | Flash Point | 112.3±27.3 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 2-(Trifluoromethoxy)benzene-1-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 262.0±40.0 °C at 760 mmHg |
| Melting Point | 27-31 °C(lit.) |
| Molecular Formula | C7H4ClF3O3S |
| Molecular Weight | 260.618 |
| Flash Point | 112.3±27.3 °C |
| Exact Mass | 259.952179 |
| PSA | 51.75000 |
| LogP | 2.94 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | JLTBWYIUMFEOTN-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccccc1OC(F)(F)F |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45-S39-S37-S36 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2909309090 |
|
~95%
2-(Trifluoromet... CAS#:103008-51-1 |
| Literature: Bayer Aktiengesellschaft Patent: US6365780 B1, 2002 ; Location in patent: Page column 5 ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-(Trifluoromethoxy)benzenesulfonyl chloride |
| WSGR BOXFFF |
| MFCD00052316 |
| Benzenesulfonyl chloride, 2-(trifluoromethoxy)- |