Sculponeatin O structure
|
Common Name | Sculponeatin O | ||
|---|---|---|---|---|
| CAS Number | 1169806-00-1 | Molecular Weight | 440.615 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 559.6±30.0 °C at 760 mmHg | |
| Molecular Formula | C28H40O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.8±18.1 °C | |
Use of Sculponeatin OSculponeatin O is a ent-kaurane diterpene derivative compound isolated from the plant Isodon sculponeata[1]. |
| Name | (5β,7β,8α,9β,10α,13α,16β)-7,16-Dihydroxykauran-17-yl phenylacetat e |
|---|---|
| Synonym | More Synonyms |
| Description | Sculponeatin O is a ent-kaurane diterpene derivative compound isolated from the plant Isodon sculponeata[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Wang F, et al. New terpenoids from Isodon sculponeata. Chem Pharm Bull (Tokyo). 2009;57(5):525-527. |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 559.6±30.0 °C at 760 mmHg |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.615 |
| Flash Point | 179.8±18.1 °C |
| Exact Mass | 440.292664 |
| PSA | 66.76000 |
| LogP | 6.32 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | RQZFFMTZMGJLHA-ZXUQJNMHSA-N |
| SMILES | CC1(C)CCCC2(C)C1CC(O)C13CC(CCC21)C(O)(COC(=O)Cc1ccccc1)C3 |
| Hazard Codes | Xi |
|---|
| sculponeatin O |
| (5β,7β,8α,9β,10α,13α,16β)-7,16-Dihydroxykauran-17-yl phenylacetate |
| 13,14-dehydro-latanoprost |