Dipiproverine structure
|
Common Name | Dipiproverine | ||
|---|---|---|---|---|
| CAS Number | 117-30-6 | Molecular Weight | 330.46400 | |
| Density | 1.09g/cm3 | Boiling Point | 449ºC at 760mmHg | |
| Molecular Formula | C20H30N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.4ºC | |
| Name | 2-piperidin-1-ylethyl 2-phenyl-2-piperidin-1-ylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 449ºC at 760mmHg |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.46400 |
| Flash Point | 225.4ºC |
| Exact Mass | 330.23100 |
| PSA | 32.78000 |
| LogP | 3.11850 |
| Vapour Pressure | 2.96E-08mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | CGYQGGSMYNXXIV-UHFFFAOYSA-N |
| SMILES | O=C(OCCN1CCCCC1)C(c1ccccc1)N1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| UNII-4XV7PTW3FZ |
| Dipiproverinum |
| Dipiproverine |
| Dipiproverin |