Anisindione structure
|
Common Name | Anisindione | ||
|---|---|---|---|---|
| CAS Number | 117-37-3 | Molecular Weight | 252.26500 | |
| Density | 1.263g/cm3 | Boiling Point | 443.9ºC at 760mmHg | |
| Molecular Formula | C16H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.8ºC | |
Use of AnisindioneAnisindione is a synthetic anticoagulant, prevents the formation of active procoagulation factors II, VII, IX, and X. |
| Name | anisindione |
|---|---|
| Synonym | More Synonyms |
| Description | Anisindione is a synthetic anticoagulant, prevents the formation of active procoagulation factors II, VII, IX, and X. |
|---|---|
| Related Catalog |
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 443.9ºC at 760mmHg |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.26500 |
| Flash Point | 199.8ºC |
| Exact Mass | 252.07900 |
| PSA | 43.37000 |
| LogP | 2.85800 |
| Vapour Pressure | 4.45E-08mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | XRCFXMGQEVUZFC-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2C(=O)c3ccccc3C2=O)cc1 |
| Storage condition | 2-8℃ |
| RIDADR | UN 2811 |
|---|---|
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2914509090 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-(4-methoxyphenyl)indene-1,3-dione |
| EINECS 204-186-6 |
| 2-(4-Methoxyphenyl)-1H-indene-1,3(2H)-dione |