Coumafuryl structure
|
Common Name | Coumafuryl | ||
|---|---|---|---|---|
| CAS Number | 117-52-2 | Molecular Weight | 298.29000 | |
| Density | 1.364g/cm3 | Boiling Point | 430.6ºC at 760mmHg | |
| Molecular Formula | C17H14O5 | Melting Point | 124° | |
| MSDS | Chinese USA | Flash Point | 214.2ºC | |
| Symbol |
GHS06, GHS08 |
Signal Word | Danger | |
Use of CoumafurylCoumafuryl is a anticoagulant rodenticide. |
| Name | coumafuryl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.364g/cm3 |
|---|---|
| Boiling Point | 430.6ºC at 760mmHg |
| Melting Point | 124° |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29000 |
| Flash Point | 214.2ºC |
| Exact Mass | 298.08400 |
| PSA | 80.65000 |
| LogP | 3.20260 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.62 |
| InChIKey | JFIXKFSJCQNGEK-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(c1ccco1)c1c(O)c2ccccc2oc1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H372-H412 |
| Precautionary Statements | P273-P301 + P310-P314 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | 25-48/25-52/53 |
| Safety Phrases | S37;S45;S61 |
| RIDADR | UN 3027 |
| RTECS | GN4850000 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2932209011 |
| HS Code | 2932209011 |
|---|---|
| Summary | 2932209011 3-(1-(furan-2-yl)-3-oxobutyl)-4-hydroxy-2h-chromen-2-one。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:0.0%。MFN tarrif:6.5%。general tariff:20.0% |
|
A comparative assessment of efficacy of three anticoagulant rodenticides.
J. Hyg. Epidemiol. Microbiol. Immunol. 26(2) , 125-30, (1982) Results are presented of feeding tests carried out with three common anticoagulant rodenticides viz., coumatetralyl, fumarin and warfarin on three common species of commensal rodents i.e., Rattus ratt... |
|
|
Coumafuryl (Fumarin) toxicity in chicks.
Avian Dis. 37(2) , 622-4, (1993) Coumafuryl (Fumarin) toxicity was diagnosed in chickens less than 1 week of age. Mortality rate was 100%. Necropsy showed crops and gizzards to be full of feed. There was diffuse hemorrhage and unclot... |
| tomarin |
| EINECS 204-195-5 |
| fumarin |
| Kill-Ko Rat |
| Mouse blues |
| 3-[(1RS)-1-(2-furyl)-3-oxobutyl]-4-hydroxycoumarin |
| MFCD00128012 |
| rac-3-[(1R)-1-(furan-2-yl)-3-oxobutyl]-4-hydroxy-2H-1-benzopyran-2-one |
| Krumkil |
| 3-[1-(2-furanyl)-3-oxobutyl]-4-hydroxy-2H-1-benzopyran-2-one |
| Lurat |
| Ratafin |
| 3-[1-(furan-2-yl)-3-oxobutyl]-4-hydroxychromen-2-one |
| COUMAFURYL |