Liproxstatin-1 analog structure
|
Common Name | Liproxstatin-1 analog | ||
|---|---|---|---|---|
| CAS Number | 1170643-61-4 | Molecular Weight | 272.389 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 474.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H24N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.5±28.7 °C | |
Use of Liproxstatin-1 analogLiproxstatin-1 analog is an analog of the ferroptosis inhibitor liproxstatin-1 |
| Name | N-(2-Methyl-2-propanyl)-1'H-spiro[piperidine-4,2'-quinoxalin]-3'-amine |
|---|---|
| Synonym | More Synonyms |
| Description | Liproxstatin-1 analog is an analog of the ferroptosis inhibitor liproxstatin-1 |
|---|
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 474.1±45.0 °C at 760 mmHg |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.389 |
| Flash Point | 240.5±28.7 °C |
| Exact Mass | 272.200104 |
| LogP | 1.50 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | XSZONDARYJTXFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N=C1Nc2ccccc2NC12CCNCC2 |
| Hazard Codes | Xi |
|---|
| MFCD14281787 |
| N-(2-Methyl-2-propanyl)-1'H-spiro[piperidine-4,2'-quinoxalin]-3'-amine |
| Spiro[piperidine-4,2'(1'H)-quinoxalin]-3'-amine, N-(1,1-dimethylethyl)- |