Boroxin,tris(cyclohexyloxy)- (6CI,7CI,8CI,9CI) structure
|
Common Name | Boroxin,tris(cyclohexyloxy)- (6CI,7CI,8CI,9CI) | ||
|---|---|---|---|---|
| CAS Number | 1172-69-6 | Molecular Weight | 377.88400 | |
| Density | 1.06g/cm3 | Boiling Point | 427.4ºC at 760mmHg | |
| Molecular Formula | C18H33B3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.3ºC | |
| Name | 2,4,6-tricyclohexyloxy-1,3,5,2,4,6-trioxatriborinane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06g/cm3 |
|---|---|
| Boiling Point | 427.4ºC at 760mmHg |
| Molecular Formula | C18H33B3O6 |
| Molecular Weight | 377.88400 |
| Flash Point | 212.3ºC |
| Exact Mass | 378.25600 |
| PSA | 55.38000 |
| LogP | 4.05240 |
| Vapour Pressure | 4.08E-07mmHg at 25°C |
| Index of Refraction | 1.466 |
| InChIKey | GNENVASJJIUNER-UHFFFAOYSA-N |
| SMILES | C1CCC(OB2OB(OC3CCCCC3)OB(OC3CCCCC3)O2)CC1 |
| HS Code | 2934999090 |
|---|
|
~%
Boroxin,tris(cy... CAS#:1172-69-6 |
| Literature: Gmelin Handbook: B: B-Verb.13, 4.5.3.4, page 167 - 176 |
|
~%
Boroxin,tris(cy... CAS#:1172-69-6 |
| Literature: O'Connor; Nace Journal of the American Chemical Society, 1955 , vol. 77, p. 1578 |
|
~%
Boroxin,tris(cy... CAS#:1172-69-6 |
| Literature: Gmelin Handbook: B: B-Verb.13, 4.5.3.4, page 167 - 176 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Cyclohexyl-metaborat |
| Tricyclohexyloxy-boroxol |