1-[6-methyl-8-(3,4,5-trimethoxyphenyl)-8H-[1,3]dioxolo[4,5-g]chromen-7-yl]ethanone structure
|
Common Name | 1-[6-methyl-8-(3,4,5-trimethoxyphenyl)-8H-[1,3]dioxolo[4,5-g]chromen-7-yl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 117233-19-9 | Molecular Weight | 398.40600 | |
| Density | 1.264g/cm3 | Boiling Point | 502.1ºC at 760 mmHg | |
| Molecular Formula | C22H22O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.3ºC | |
| Name | 1-[6-methyl-8-(3,4,5-trimethoxyphenyl)-8H-[1,3]dioxolo[4,5-g]chromen-7-yl]ethanone |
|---|
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 502.1ºC at 760 mmHg |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.40600 |
| Flash Point | 218.3ºC |
| Exact Mass | 398.13700 |
| PSA | 72.45000 |
| LogP | 3.82840 |
| Vapour Pressure | 3.29E-10mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | BNPBTCRKVWFLHV-UHFFFAOYSA-N |
| SMILES | COc1cc(C2C(C(C)=O)=C(C)Oc3cc4c(cc32)OCO4)cc(OC)c1OC |
|
~%
1-[6-methyl-8-(... CAS#:117233-19-9 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 5 p. 1349 - 1352 |
|
~%
1-[6-methyl-8-(... CAS#:117233-19-9 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 5 p. 1349 - 1352 |
|
~%
1-[6-methyl-8-(... CAS#:117233-19-9 |
| Literature: Jurd Journal of Heterocyclic Chemistry, 1989 , vol. 26, # 5 p. 1349 - 1352 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |