3-(2,3-DICHLOROPHENYL)-BETA-ALANINE structure
|
Common Name | 3-(2,3-DICHLOROPHENYL)-BETA-ALANINE | ||
|---|---|---|---|---|
| CAS Number | 117391-56-7 | Molecular Weight | 234.07900 | |
| Density | 1.447 g/cm3 | Boiling Point | 363ºC at 760 mmHg | |
| Molecular Formula | C9H9Cl2NO2 | Melting Point | 232-235ºC | |
| MSDS | N/A | Flash Point | 173.3ºC | |
| Name | 3-Amino-3-(2,3-dichlorophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447 g/cm3 |
|---|---|
| Boiling Point | 363ºC at 760 mmHg |
| Melting Point | 232-235ºC |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.07900 |
| Flash Point | 173.3ºC |
| Exact Mass | 233.00100 |
| PSA | 63.32000 |
| LogP | 3.16820 |
| Vapour Pressure | 6.62E-06mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | GQKLESLYMHWBOP-UHFFFAOYSA-N |
| SMILES | NC(CC(=O)O)c1cccc(Cl)c1Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2922499990 |
|
~%
3-(2,3-DICHLORO... CAS#:117391-56-7 |
| Literature: Bulletin de la Societe Chimique de France, , # 6 p. 1079 - 1083 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Benzenepropanoic acid,b-amino-2,3-dichloro |
| 3-Amino-3-(2,3-dichloro-phenyl)-propionic acid |