coronarin E structure
|
Common Name | coronarin E | ||
|---|---|---|---|---|
| CAS Number | 117591-81-8 | Molecular Weight | 284.436 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 359.9±21.0 °C at 760 mmHg | |
| Molecular Formula | C20H28O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.2±8.9 °C | |
Use of coronarin ECoronarin E is a compound isolated from the rhizome of Hedychium coronarium (Zingiberaceae)[1]. |
| Name | Coronarin E |
|---|---|
| Synonym | More Synonyms |
| Description | Coronarin E is a compound isolated from the rhizome of Hedychium coronarium (Zingiberaceae)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 359.9±21.0 °C at 760 mmHg |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.436 |
| Flash Point | 165.2±8.9 °C |
| Exact Mass | 284.214020 |
| PSA | 13.14000 |
| LogP | 7.76 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.530 |
| InChIKey | QXVXYNOIXUIXBI-BQYQJAHWSA-N |
| SMILES | C=C1CCC2C(C)(C)CCCC2(C)C1C=Cc1ccoc1 |
| Hazard Codes | Xi |
|---|
| coronarin E |
| 3-{(E)-2-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylidenedecahydronaphthalen-1-yl]ethenyl}furan |
| 3-{(E)-2-[(1S,4aS,8aS)-5,5,8a-Trimethyl-2-methylenedecahydro-1-naphthalenyl]vinyl}furan |
| Furan, 3-[(E)-2-[(1S,4aS,8aS)-decahydro-5,5,8a-trimethyl-2-methylene-1-naphthalenyl]ethenyl]- |