1-Hydroxy-1-(4-hydroxy-2-methoxyphenyl)-3-(4-hydroxyphenyl)propan-2-one structure
|
Common Name | 1-Hydroxy-1-(4-hydroxy-2-methoxyphenyl)-3-(4-hydroxyphenyl)propan-2-one | ||
|---|---|---|---|---|
| CAS Number | 117614-84-3 | Molecular Weight | 288.30 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 538.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.7±23.6 °C | |
Use of 1-Hydroxy-1-(4-hydroxy-2-methoxyphenyl)-3-(4-hydroxyphenyl)propan-2-one3-(4-Hydroxyphenyl)propan-2-one is a compound that can be extracted from Xanthocercis zambesiaca[1]. |
| Name | 1-hydroxy-1-(4-hydroxy-2-methoxyphenyl)-3-(4-hydroxyphenyl)propan-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | 3-(4-Hydroxyphenyl)propan-2-one is a compound that can be extracted from Xanthocercis zambesiaca[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 538.8±50.0 °C at 760 mmHg |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 288.30 |
| Flash Point | 202.7±23.6 °C |
| Exact Mass | 288.099762 |
| PSA | 86.99000 |
| LogP | 1.25 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | BAVJPTQBNBQJFK-UHFFFAOYSA-N |
| SMILES | COc1cc(O)ccc1C(O)C(=O)Cc1ccc(O)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-Propanone, 1-hydroxy-1-(4-hydroxy-2-methoxyphenyl)-3-(4-hydroxyphenyl)- |
| 1-Hydroxy-1-(4-hydroxy-2-methoxyphenyl)-3-(4-hydroxyphenyl)acetone |