2-(2-Methoxyphenyl)-5-oxotetrahydrofuran-3-carboxylic acid structure
|
Common Name | 2-(2-Methoxyphenyl)-5-oxotetrahydrofuran-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 117621-06-4 | Molecular Weight | 236.221 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 479.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H12O5 | Melting Point | 124-125ºC | |
| MSDS | USA | Flash Point | 190.6±22.2 °C | |
| Name | 2-(2-Methoxyphenyl)-5-oxotetrahydrofuran-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 479.1±45.0 °C at 760 mmHg |
| Melting Point | 124-125ºC |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.221 |
| Flash Point | 190.6±22.2 °C |
| Exact Mass | 236.068466 |
| PSA | 72.83000 |
| LogP | 0.44 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | LMMNYYZCVYAOOF-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C1OC(=O)CC1C(=O)O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S26-S36/37/39 |
| HS Code | 2932190090 |
|
~49%
2-(2-Methoxyphe... CAS#:117621-06-4 |
| Literature: EVOLVA SA Patent: US2011/178112 A1, 2011 ; Location in patent: Page/Page column 12-14; 17 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-(2-Methoxyphenyl)-5-oxotetrahydro-3-furancarboxylic acid |
| 2-methoxy-paraconic acid |
| 3-Furancarboxylic acid, tetrahydro-2-(2-methoxyphenyl)-5-oxo- |
| 2-(2-Methoxyphenyl)-5-Oxotetrahydrofuran-3-Carboxylic Acid |
| 2-(1-ETHYL-1H-PYRAZOL-4-YL)-QUINOLINE-4-CARBOXYLIC ACID |
| tetrahydro-2-o-methoxyphenyl-5-oxo-3-furancarboxylic acid |