(+)-Blebbistatin structure
|
Common Name | (+)-Blebbistatin | ||
|---|---|---|---|---|
| CAS Number | 1177356-70-5 | Molecular Weight | 292.332 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 507.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C18H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.6±32.9 °C | |
Use of (+)-Blebbistatin(+)-Blebbistatin is the inactive enantiomer of (–)-Blebbistatin. (–)-Blebbistatin is a selective inhibitor of myosin II ATPase[1]. |
| Name | (R)-(+)-Blebbistatin |
|---|---|
| Synonym | More Synonyms |
| Description | (+)-Blebbistatin is the inactive enantiomer of (–)-Blebbistatin. (–)-Blebbistatin is a selective inhibitor of myosin II ATPase[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 507.3±60.0 °C at 760 mmHg |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.332 |
| Flash Point | 260.6±32.9 °C |
| Exact Mass | 292.121185 |
| PSA | 52.90000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | LZAXPYOBKSJSEX-SFHVURJKSA-N |
| SMILES | Cc1ccc2c(c1)C(=O)C1(O)CCN(c3ccccc3)C1=N2 |
| (−)-Blebbistatin |
| (3aR)-3a-Hydroxy-6-methyl-1-phenyl-1,2,3,3a-tetrahydro-4H-pyrrolo[2,3-b]quinolin-4-one |
| (3aR)-3a-hydroxy-6-methyl-1-phenyl-2,3-dihydropyrrolo[2,3-b]quinolin-4-one |
| Blebbistatin |
| (3aS)-3a-Hydroxy-6-methyl-1-phenyl-1,2,3,3a-tetrahydro-4H-pyrrolo[2,3-b]quinolin-4-one |
| 4H-Pyrrolo[2,3-b]quinolin-4-one, 1,2,3,3a-tetrahydro-3a-hydroxy-6-methyl-1-phenyl-, (3aS)- |
| 4H-Pyrrolo[2,3-b]quinolin-4-one, 1,2,3,3a-tetrahydro-3a-hydroxy-6-methyl-1-phenyl-, (3aR)- |
| (+)-Blebbistatin |
| (S)-Blebbistatin |