2-(Naphthalen-1-yl)pyrrolidine hemioxalate
Modify Date: 2025-11-03 09:34:19
2-(Naphthalen-1-yl)pyrrolidine hemioxalate structure
|
Common Name | 2-(Naphthalen-1-yl)pyrrolidine hemioxalate | ||
|---|---|---|---|---|
| CAS Number | 1177357-40-2 | Molecular Weight | 484.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H32N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Naphthalen-1-yl)pyrrolidine hemioxalate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C30H32N2O4 |
|---|---|
| Molecular Weight | 484.6 |
| InChIKey | XTFWCWUGIIXHSJ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(=O)O.c1ccc2c(C3CCCN3)cccc2c1.c1ccc2c(C3CCCN3)cccc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(Naphthalen-1-yl)pyrrolidine hemioxalate? |
| A: InChIKey of 2-(Naphthalen-1-yl)pyrrolidine hemioxalate is XTFWCWUGIIXHSJ-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(Naphthalen-1-yl)pyrrolidine hemioxalate? |
| A: The English name of 2-(Naphthalen-1-yl)pyrrolidine hemioxalate is 2-(Naphthalen-1-yl)pyrrolidine hemioxalate. |
| Q: What is the molecular formula of 2-(Naphthalen-1-yl)pyrrolidine hemioxalate? |
| A: Molecular formula of 2-(Naphthalen-1-yl)pyrrolidine hemioxalate is C30H32N2O4. |
| Q: What is the CAS number of 2-(Naphthalen-1-yl)pyrrolidine hemioxalate? |
| A: CAS number of 2-(Naphthalen-1-yl)pyrrolidine hemioxalate is 1177357-40-2. |
| Q: What is the SMILES notation of 2-(Naphthalen-1-yl)pyrrolidine hemioxalate? |
| A: SMILES notation of 2-(Naphthalen-1-yl)pyrrolidine hemioxalate is O=C(O)C(=O)O.c1ccc2c(C3CCCN3)cccc2c1.c1ccc2c(C3CCCN3)cccc2c1. |
| Q: What is the molecular weight of 2-(Naphthalen-1-yl)pyrrolidine hemioxalate? |
| A: Molecular weight of 2-(Naphthalen-1-yl)pyrrolidine hemioxalate is 484.6. |
| Q: What is the Chinese name of 1177357-40-2? |
| A: Chinese name of 1177357-40-2 is 1177357-40-2. |