4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid
![4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid Structure](https://image.chemsrc.com/caspic/207/117821-33-7.png)
4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid structure
|
Common Name | 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 117821-33-7 | Molecular Weight | 225.24100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid (Chinese name: 4-[N,N-双(2-羟乙基)氨基]苯甲酸)， CAS number: 117821-33-7，molecular formula: C11H15NO4，molecular weight: 225.24100，for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15NO4 |
|---|---|
| Molecular Weight | 225.24100 |
| Exact Mass | 225.10000 |
| PSA | 81.00000 |
| LogP | 0.17580 |
| InChIKey | PKTBDXPTUWRSHI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(N(CCO)CCO)cc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
![N-[4-(acridin-9-ylamino)butyl]-4-[bis(2-chloroethyl)amino]benzamide structure](https://image.chemsrc.com/caspic/254/125173-78-6.png)
CAS#:125173-78-6![N-[4-[N-(benzyloxycarbonyl)amino]butyl]-4-[N,N-bis(2-chloroethyl)amino]benzamide structure](https://image.chemsrc.com/caspic/312/125174-14-3.png)
CAS#:125174-14-3This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid? |
| A: LogP of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid is 0.17580. |
| Q: What is the polar surface area (PSA) of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid? |
| A: Polar surface area (PSA) of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid is 81.00000. |
| Q: What is the molecular formula of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid? |
| A: Molecular formula of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid is C11H15NO4. |
| Q: What is the molecular weight of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid? |
| A: Molecular weight of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid is 225.24100. |
| Q: What is the Chinese name of 117821-33-7? |
| A: Chinese name of 117821-33-7 is 117821-33-7. |
| Q: What is the CAS number of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid? |
| A: CAS number of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid is 117821-33-7. |
| Q: What is the SMILES notation of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid? |
| A: SMILES notation of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid is O=C(O)c1ccc(N(CCO)CCO)cc1. |
| Q: What are the downstream products of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid? |
| A: Related downstream products(CAS) of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid: 125173-78-6;125174-14-3. |
| Q: What is the InChIKey of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid? |
| A: InChIKey of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid is PKTBDXPTUWRSHI-UHFFFAOYSA-N. |
| Q: What is the English name of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid? |
| A: The English name of 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid is 4-[N,N-bis(2-hydroxyethyl)amino]benzoic acid. |