cefazolin delta-3-methyl ester structure
|
Common Name | cefazolin delta-3-methyl ester | ||
|---|---|---|---|---|
| CAS Number | 117929-10-9 | Molecular Weight | 468.53400 | |
| Density | 1.87g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H16N8O4S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl (6R,7R)-3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanylmethyl]-8-oxo-7-[[2-(tetrazol-1-yl)acetyl]amino]-5-thia-1-azabicyclo[4.2.0]oct-3-ene-2-carboxylate |
|---|
| Density | 1.87g/cm3 |
|---|---|
| Molecular Formula | C15H16N8O4S3 |
| Molecular Weight | 468.53400 |
| Exact Mass | 468.04600 |
| PSA | 227.42000 |
| LogP | 0.22890 |
| Index of Refraction | 1.883 |
| InChIKey | VWSAVDPCHLJLPI-IAUSTGCCSA-N |
| SMILES | COC(=O)C1C(CSc2nnc(C)s2)=CSC2C(NC(=O)Cn3cnnn3)C(=O)N12 |
|
~%
cefazolin delta... CAS#:117929-10-9 |
| Literature: Yamazaki, Yutaka; McEntagart, John; Shinozaki, Katsuhiko; Yazawa, Hisatoyo Chemical and Pharmaceutical Bulletin, 1996 , vol. 44, # 3 p. 599 - 601 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |