[(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride structure
|
Common Name | [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 117983-27-4 | Molecular Weight | 257.71700 | |
| Density | N/A | Boiling Point | 287.4ºC at 760mmHg | |
| Molecular Formula | C11H16ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.6ºC | |
| Name | [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride |
|---|
| Boiling Point | 287.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.71700 |
| Flash Point | 127.6ºC |
| Exact Mass | 257.09300 |
| PSA | 48.52000 |
| LogP | 1.80000 |
| Vapour Pressure | 0.00249mmHg at 25°C |
| InChIKey | DUNVBKPFFWLPTC-UHFFFAOYSA-N |
| SMILES | C#CCC(C)OCn1cc[n+](C)c1C=NO.[Cl-] |
|
~55%
[(Z)-[1-methyl-... CAS#:117983-27-4 |
| Literature: Bedford; Harris III; Howd; Goff; Koolpe; Petesch; Koplovitz; Sultan; Musallam Journal of Medicinal Chemistry, 1989 , vol. 32, # 2 p. 504 - 516 |
|
~%
[(Z)-[1-methyl-... CAS#:117983-27-4 |
| Literature: Bedford; Harris III; Howd; Goff; Koolpe; Petesch; Koplovitz; Sultan; Musallam Journal of Medicinal Chemistry, 1989 , vol. 32, # 2 p. 504 - 516 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |