[(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride
![[(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride Structure](https://image.chemsrc.com/caspic/184/117983-27-4.png)
[(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride structure
|
Common Name | [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride | ||
|---|---|---|---|---|
| CAS Number | 117983-27-4 | Molecular Weight | 257.71700 | |
| Density | N/A | Boiling Point | 287.4ºC at 760mmHg | |
| Molecular Formula | C11H16ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 287.4ºC at 760mmHg |
|---|---|
| Molecular Formula | C11H16ClN3O2 |
| Molecular Weight | 257.71700 |
| Flash Point | 127.6ºC |
| Exact Mass | 257.09300 |
| PSA | 48.52000 |
| LogP | 1.80000 |
| Vapour Pressure | 0.00249mmHg at 25°C |
| InChIKey | DUNVBKPFFWLPTC-UHFFFAOYSA-N |
| SMILES | C#CCC(C)OCn1cc[n+](C)c1C=NO.[Cl-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~55%
[(Z)-[1-methyl-... CAS#:117983-27-4 |
| Literature: Bedford; Harris III; Howd; Goff; Koolpe; Petesch; Koplovitz; Sultan; Musallam Journal of Medicinal Chemistry, 1989 , vol. 32, # 2 p. 504 - 516 |
|
~%
[(Z)-[1-methyl-... CAS#:117983-27-4 |
| Literature: Bedford; Harris III; Howd; Goff; Koolpe; Petesch; Koplovitz; Sultan; Musallam Journal of Medicinal Chemistry, 1989 , vol. 32, # 2 p. 504 - 516 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride? |
| A: LogP of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride is 1.80000. |
| Q: What is the Chinese name of 117983-27-4? |
| A: Chinese name of 117983-27-4 is 117983-27-4. |
| Q: What is the CAS number of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride? |
| A: CAS number of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride is 117983-27-4. |
| Q: What is the boiling point of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride? |
| A: Boiling point of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride is 287.4ºC at 760mmHg. |
| Q: What is the polar surface area (PSA) of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride? |
| A: Polar surface area (PSA) of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride is 48.52000. |
| Q: What is the molecular weight of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride? |
| A: Molecular weight of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride is 257.71700. |
| Q: What is the molecular formula of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride? |
| A: Molecular formula of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride is C11H16ClN3O2. |
| Q: What is the English name of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride? |
| A: The English name of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride is [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride. |
| Q: What is the SMILES notation of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride? |
| A: SMILES notation of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride is C#CCC(C)OCn1cc[n+](C)c1C=NO.[Cl-]. |
| Q: What are the upstream materials of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride? |
| A: Related upstream materials(CAS) of [(Z)-[1-methyl-3-(pent-4-yn-2-yloxymethyl)imidazol-2-ylidene]methyl]-oxoazanium,chloride: 117983-61-6;20062-62-8;2117-11-5. |