1,3-Diphenylguanidinium phthalate structure
|
Common Name | 1,3-Diphenylguanidinium phthalate | ||
|---|---|---|---|---|
| CAS Number | 118-99-0 | Molecular Weight | 588.656 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H32N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-Diphenylguanidinium phthalate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C34H32N6O4 |
|---|---|
| Molecular Weight | 588.656 |
| Exact Mass | 588.248474 |
| InChIKey | KFXKTRNHRONVKY-UHFFFAOYSA-N |
| SMILES | NC(=Nc1ccccc1)Nc1ccccc1.NC(=Nc1ccccc1)Nc1ccccc1.O=C(O)c1ccccc1C(=O)O |
| EINECS 204-291-7 |
| Bis[N-(N-phenylcarbamimidoyl)anilinium] phthalate |
| Phthalic acid - 1,2-diphenylguanidine (1:2) |
| 1,2-benzenedicarboxylic acid, compd. with guanidine, N,N'-diphenyl- (1:2) |
| 1,2-Benzenedicarboxylic acid, compd. with guanidine, N,N''-diphenyl- (1:2) |