1,1-diphenylguanidine,phthalic acid structure
|
Common Name | 1,1-diphenylguanidine,phthalic acid | ||
|---|---|---|---|---|
| CAS Number | 17573-13-6 | Molecular Weight | 377.39300 | |
| Density | N/A | Boiling Point | 600.6ºC at 760mmHg | |
| Molecular Formula | C21H19N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.1ºC | |
| Name | 1,1-diphenylguanidine,phthalic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 600.6ºC at 760mmHg |
|---|---|
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.39300 |
| Flash Point | 317.1ºC |
| Exact Mass | 377.13800 |
| PSA | 122.51000 |
| LogP | 4.47410 |
| Vapour Pressure | 1.79E-08mmHg at 25°C |
| Index of Refraction | 1.456 |
| InChIKey | JSCFNQDWXBNVBP-UHFFFAOYSA-N |
| SMILES | NC(=Nc1ccccc1)Nc1ccccc1.O=C(O)c1ccccc1C(=O)O |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,3-diphenylguanidinium phthalate |
| DIPHENYLGUANIDINE PHTHALATE |
| 1,1-diphenylguanidine |
| N,N'-Diphenyl-guanidin,Phthalat |
| N,N'-diphenyl-guanidine,phthalate |