Volvaltrate B structure
|
Common Name | Volvaltrate B | ||
|---|---|---|---|---|
| CAS Number | 1181224-13-4 | Molecular Weight | 577.06 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 632.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H41ClO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.2±31.5 °C | |
Use of Volvaltrate BVolvaltrate B is an anticancer agent, iridoid, can be obtained from the root of valerian (Valeriana officinalis). Volvaltrate B is effective against ovarian tumors in female mice. Volvaltrate B has the potential to study cancer[1][2]. |
| Name | ((1S,4aR,6S,7S,7aS)-6-acetoxy-7-(chloromethyl)-4a,7-dihydroxy-1-((3-methylbutanoyl)oxy)-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-yl)methyl (R)-3-methyl-2-((3-methylbutanoyl)oxy)butanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Volvaltrate B is an anticancer agent, iridoid, can be obtained from the root of valerian (Valeriana officinalis). Volvaltrate B is effective against ovarian tumors in female mice. Volvaltrate B has the potential to study cancer[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 632.3±55.0 °C at 760 mmHg |
| Molecular Formula | C27H41ClO11 |
| Molecular Weight | 577.06 |
| Flash Point | 336.2±31.5 °C |
| Exact Mass | 576.233765 |
| PSA | 154.89000 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±4.2 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | OEVPPNBQSYOUCV-PXKJKYEHSA-N |
| SMILES | CC(=O)OC1CC2(O)C(COC(=O)C(OC(=O)CC(C)C)C(C)C)=COC(OC(=O)CC(C)C)C2C1(O)CCl |
| Hazard Codes | Xi |
|---|
| Butanoic acid, 3-methyl-2-(3-methyl-1-oxobutoxy)-, [(1S,4aR,6S,7S,7aS)-6-(acetyloxy)-7-(chloromethyl)-1,4a,5,6,7,7a-hexahydro-4a,7-dihydroxy-1-(3-methyl-1-oxobutoxy)cyclopenta[c]pyran-4-yl]methyl ester, (2R)- |
| {(1S,4aR,6S,7S,7aS)-6-Acetoxy-7-(chloromethyl)-4a,7-dihydroxy-1-[(3-methylbutanoyl)oxy]-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-yl}methyl (2R)-3-methyl-2-[(3-methylbutanoyl)oxy]butanoate |