Gliclazide (D4) structure
|
Common Name | Gliclazide (D4) | ||
|---|---|---|---|---|
| CAS Number | 1185039-30-8 | Molecular Weight | 323.410 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H21N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Gliclazide (D4)Gliclazide D4 (S1702 D4) is the deuterium labeled Gliclazide. Gliclazide (S1702) is a whole-cell beta-cell ATP-sensitive potassium currents blocker with an IC50 of 184 nM. Gliclazide is used as an antidiabetic[1]. |
| Name | Gliclazide |
|---|---|
| Synonym | More Synonyms |
| Description | Gliclazide D4 (S1702 D4) is the deuterium labeled Gliclazide. Gliclazide (S1702) is a whole-cell beta-cell ATP-sensitive potassium currents blocker with an IC50 of 184 nM. Gliclazide is used as an antidiabetic[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.410 |
| Exact Mass | 323.130371 |
| LogP | 1.57 |
| Index of Refraction | 1.624 |
| InChIKey | BOVGTQGAOIONJV-KDWZCNHSSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)NN2CC3CCCC3C2)cc1 |
| Glimicron |
| 1-(Hexahydrocyclopenta[c]pyrrol-2(1H)-yl)-3-(p-tolylsulfonyl)urea |
| Gliclazide |
| N-(4-Methylbenzenesulfonyl)-N'-(3-azabicyclo[3.3.0]oct-3-yl)urea |
| N-[[(Hexahydrocyclopenta[c]pyrrol-2(1H)-yl)amino]carbonyl]-4-methylbenzenesulfonamide |
| Nordialex |
| Benzenesulfonamide, N-[[(hexahydrocyclopenta[c]pyrrol-2(1H)-yl)amino]carbonyl]-4-methyl- |
| N-(Hexahydrocyclopenta[c]pyrrol-2(1H)-ylcarbamoyl)-4-methylbenzenesulfonamide |
| 1-(3-Azabicyclo[3.3.0]oct-3-yl)-3-(p-tolylsulfonyl)urea |
| Diamicron |
| N-[(hexahydrocyclopenta[c]pyrrol-2(1H)-ylamino)carbonyl]-4-methylbenzenesulfonamide |
| Benzenesulfonamide, N-(((hexahydrocyclopenta(c)pyrrol-2(1H)-yl)amino)carbonyl)-4-methyl- |