N-[2-(4-Amino-3-methylphenoxy)ethyl]-N,N-diethylamine dihydrochloride structure
|
Common Name | N-[2-(4-Amino-3-methylphenoxy)ethyl]-N,N-diethylamine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1185176-52-6 | Molecular Weight | 295.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H24Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(4-Amino-3-methylphenoxy)ethyl]-N,N-diethylamine dihydrochloride |
|---|
| Molecular Formula | C13H24Cl2N2O |
|---|---|
| Molecular Weight | 295.24800 |
| Exact Mass | 294.12700 |
| PSA | 38.49000 |
| LogP | 4.48300 |
| InChIKey | JTCWSJIWLIDWFA-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOc1ccc(N)c(C)c1.Cl.Cl |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |